2-pheny-1H-imidazo[1,2-a]pyridine-3-carboxylic acid

2-pheny-1H-imidazo[1,2-a]pyridine-3-carboxylic acid - Names and Identifiers

Name	2-PHENYLIMIDAZO[1,2-A]PYRIDINE-3-CARBOXYLIC ACID
Synonyms	2-phenylH-iMidazo[1,2-a]pyridine 3-Carboxy-2-phenylimidazo[1,2-a]pyridine 2-phenyl-imidazo[1,2-a]pyridine-3-carboxylicacid 2-PHENYLIMIDAZO[1,2-A]PYRIDINE-3-CARBOXYLIC ACID 2-phenylH-imidazo[1,2-a]pyridine-3-carboxylicacid IMidazo[1,2-a]pyridine-3-carboxylic acid, 2-phenyl- 2-pheny-1H-imidazo[1,2-a]pyridine-3-carboxylic acid imidazo[1,2-a]pyridine-3-carboxylic acid, 2-phenyl- 2-Phenyl-1H-iMidazo[1,2-a]pyridine-3-carboxylic acid
CAS	123533-41-5
InChI	InChI=1/C14H10N2O2/c17-14(18)13-12(10-6-2-1-3-7-10)15-11-8-4-5-9-16(11)13/h1-9H,(H,17,18)

2-pheny-1H-imidazo[1,2-a]pyridine-3-carboxylic acid - Physico-chemical Properties

Molecular Formula	C14H10N2O2
Molar Mass	238.24
Density	1.305g/cm³
Storage Condition	Room Temprature
Refractive Index	1.669
MDL	MFCD00269226

2-pheny-1H-imidazo[1,2-a]pyridine-3-carboxylic acid - Introduction

2-Phenylimidazole [1,2-a] pyridine-3-carboxylic acid (abbreviated as BPPA) is an organic compound. Its structural formula is C15H10N2O2. The following is a description of the nature, use, formulation and safety information of BPPA:

Nature:
1. Appearance: white crystalline powder.
2. solubility: BPPA soluble in most organic solvents, such as alcohol, ether, ketone.
3. Stability: BPPA is stable at room temperature, but can be decomposed at high temperature.
4. pH: BPPA is neutral in aqueous solution.

Use:
1. Chemical synthesis: BPPA is commonly used as raw materials or intermediates in organic synthesis, and can be used in the synthesis of pyridine derivatives, imidazoles, etc.
2. Optical materials: Because BPPA has good optical properties, it can be used to prepare optoelectronic devices, fluorescent probes, etc.
3. Biomedicine: BPPA also has certain biological activity and can be used in drug research and medical diagnosis.

Preparation Method:
BPPA is commonly prepared by the amide dichloride method. Specific steps are as follows:
1. benzaldehyde and dichloride amide react under alkaline conditions to generate 2-phenyl imidazole [1,2-a] pyridine.
2. 2-Phenylimidazole [1,2-a] pyridine is then treated with aqueous sodium hydroxide to give 2-phenylimidazole [1,2-a] pyridine-3-carboxylic acid.

Safety Information:
1. BPPA is irritating. After contact with skin and eyes, rinse with plenty of water immediately and seek medical treatment.
2. in the use or storage of BPPA should pay attention to avoid fire, to prevent fire and explosion.
3. BPPA is limited to laboratory use and should be kept away from children.

Last Update：2024-04-09 21:04:16